About 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine
1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine (PubChem CID 12649365) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine.
Molecular Properties
| Compound Name | 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine |
| PubChem CID | 12649365 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine |
| SMILES | COC(OC)(c1ccc(C)cc1)N(C)C |
| InChI | InChI=1S/C12H19NO2/c1-10-6-8-11(9-7-10)12(14-4,15-5)13(2)3/h6-9H,1-5H3 |
| InChIKey | BABAEUYBVWSKDX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine?
The IUPAC name of 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine (CID 12649365) is 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine.
What is the SMILES notation for 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine?
The canonical SMILES for 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine is COC(OC)(c1ccc(C)cc1)N(C)C.
What is the InChIKey of 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine?
The InChIKey is BABAEUYBVWSKDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-10-6-8-11(9-7-10)12(14-4,15-5)13(2)3/h6-9H,1-5H3.
What are the key properties of 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine?
1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine has a molecular weight of 209.29 g/mol, XLogP of 1.96, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxy-N,N-dimethyl-1-(4-methylphenyl)methanamine is sourced from PubChem (CID 12649365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).