C18H23F3N2O3 — CID 126493718
2,2,2-trifluoro-1-[(1S,9R)-5-hydroxy-6-(methoxyamino)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]ethanone (PubChem CID 126493718) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(1S,9R)-5-hydroxy-6-(methoxyamino)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(1S,9R)-5-hydroxy-6-(methoxyamino)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]ethanone |
|---|---|
| PubChem CID | 126493718 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2,2,2-trifluoro-1-[(1S,9R)-5-hydroxy-6-(methoxyamino)-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]ethanone |
| SMILES | CONc1c(O)ccc2c1C[C@H]1N(C(=O)C(F)(F)F)CC[C@]2(C)C1(C)C |
| InChI | InChI=1S/C18H23F3N2O3/c1-16(2)13-9-10-11(5-6-12(24)14(10)22-26-4)17(16,3)7-8-23(13)15(25)18(19,20)21/h5-6,13,22,24H,7-9H2,1-4H3/t13-,17+/m1/s1 |
| InChIKey | CNWZMVCUVVGVFN-DYVFJYSZSA-N |
| XLogP | 3.37 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|