difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid

C3HF5O6S — CID 126494240

IUPACdifluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid
SMILESO=S(=O)(O)C(F)(F)OOOC(F)=C(F)F
InChIInChI=1S/C3HF5O6S/c4-1(5)2(6)12-14-13-3(7,8)15(9,10)11/h(H,9,10,11)
InChIKeyAYLKKIWKJPJXRT-UHFFFAOYSA-N
MW260.09 g/mol
LogP1.34
Rot. Bonds5

About difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid

difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid (PubChem CID 126494240) has the molecular formula C3HF5O6S and a molecular weight of 260.09 g/mol. Its IUPAC name is difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid.

Molecular Properties

Compound Namedifluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid
PubChem CID126494240
Molecular FormulaC3HF5O6S
Molecular Weight260.09 g/mol
Exact Mass259.94
IUPAC Namedifluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid
SMILESO=S(=O)(O)C(F)(F)OOOC(F)=C(F)F
InChIInChI=1S/C3HF5O6S/c4-1(5)2(6)12-14-13-3(7,8)15(9,10)11/h(H,9,10,11)
InChIKeyAYLKKIWKJPJXRT-UHFFFAOYSA-N
XLogP1.34
TPSA82.06 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.09
LogP ≤ 51.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid?
The IUPAC name of difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid (CID 126494240) is difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid.
What is the SMILES notation for difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid?
The canonical SMILES for difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid is O=S(=O)(O)C(F)(F)OOOC(F)=C(F)F.
What is the InChIKey of difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid?
The InChIKey is AYLKKIWKJPJXRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HF5O6S/c4-1(5)2(6)12-14-13-3(7,8)15(9,10)11/h(H,9,10,11).
What are the key properties of difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid?
difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid has a molecular weight of 260.09 g/mol, XLogP of 1.34, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for difluoro(1,2,2-trifluoroethenoxyperoxy)methanesulfonic acid is sourced from PubChem (CID 126494240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).