About 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine
4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine (PubChem CID 126494263) has the molecular formula C12H19NO2S
and a molecular weight of 241.36 g/mol. Its IUPAC name is 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine |
| PubChem CID | 126494263 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine |
| SMILES | CS(=O)(=O)C1=CC(C2CCNCC2)CC=C1 |
| InChI | InChI=1S/C12H19NO2S/c1-16(14,15)12-4-2-3-11(9-12)10-5-7-13-8-6-10/h2,4,9-11,13H,3,5-8H2,1H3 |
| InChIKey | SSBSSICIMWOVLH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine?
The IUPAC name of 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine (CID 126494263) is 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine.
What is the SMILES notation for 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine?
The canonical SMILES for 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine is CS(=O)(=O)C1=CC(C2CCNCC2)CC=C1.
What is the InChIKey of 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine?
The InChIKey is SSBSSICIMWOVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2S/c1-16(14,15)12-4-2-3-11(9-12)10-5-7-13-8-6-10/h2,4,9-11,13H,3,5-8H2,1H3.
What are the key properties of 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine?
4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine has a molecular weight of 241.36 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylsulfonylcyclohexa-2,4-dien-1-yl)piperidine is sourced from PubChem (CID 126494263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).