About 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol
2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol (PubChem CID 126494281) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol |
| PubChem CID | 126494281 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol |
| SMILES | C/C=C(OCCO)\C(CC)=C(\N)C(C)CC |
| InChI | InChI=1S/C13H25NO2/c1-5-10(4)13(14)11(6-2)12(7-3)16-9-8-15/h7,10,15H,5-6,8-9,14H2,1-4H3/b12-7+,13-11+ |
| InChIKey | MWVAKPXECCYTQU-ZPLWXOMKSA-N |
| XLogP | 2.57 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol?
The IUPAC name of 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol (CID 126494281) is 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol.
What is the SMILES notation for 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol?
The canonical SMILES for 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol is C/C=C(OCCO)\C(CC)=C(\N)C(C)CC.
What is the InChIKey of 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol?
The InChIKey is MWVAKPXECCYTQU-ZPLWXOMKSA-N. The full InChI is InChI=1S/C13H25NO2/c1-5-10(4)13(14)11(6-2)12(7-3)16-9-8-15/h7,10,15H,5-6,8-9,14H2,1-4H3/b12-7+,13-11+.
What are the key properties of 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol?
2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol has a molecular weight of 227.35 g/mol, XLogP of 2.57, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E,4E)-5-amino-4-ethyl-6-methylocta-2,4-dien-3-yl]oxyethanol is sourced from PubChem (CID 126494281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).