About 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole
4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole (PubChem CID 126494292) has the molecular formula C24H29FN4
and a molecular weight of 392.52 g/mol. Its IUPAC name is 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole.
Molecular Properties
| Compound Name | 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole |
| PubChem CID | 126494292 |
| Molecular Formula | C24H29FN4 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole |
| SMILES | Cc1ccc2c(c(C)nn2CC(C)(C)c2c(F)ccc3cn[nH]c23)c1C(C)(C)C |
| InChI | InChI=1S/C24H29FN4/c1-14-8-11-18-19(20(14)23(3,4)5)15(2)28-29(18)13-24(6,7)21-17(25)10-9-16-12-26-27-22(16)21/h8-12H,13H2,1-7H3,(H,26,27) |
| InChIKey | ZSWJKLDKJPEIEA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole?
The IUPAC name of 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole (CID 126494292) is 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole.
What is the SMILES notation for 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole?
The canonical SMILES for 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole is Cc1ccc2c(c(C)nn2CC(C)(C)c2c(F)ccc3cn[nH]c23)c1C(C)(C)C.
What is the InChIKey of 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole?
The InChIKey is ZSWJKLDKJPEIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29FN4/c1-14-8-11-18-19(20(14)23(3,4)5)15(2)28-29(18)13-24(6,7)21-17(25)10-9-16-12-26-27-22(16)21/h8-12H,13H2,1-7H3,(H,26,27).
What are the key properties of 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole?
4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole has a molecular weight of 392.52 g/mol, XLogP of 5.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-[2-(6-fluoro-1H-indazol-7-yl)-2-methylpropyl]-3,5-dimethylindazole is sourced from PubChem (CID 126494292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).