C15H25NS — CID 126494315
4-[(2E,4Z)-6-methylsulfanylhexa-2,4-dien-2-yl]-1-propyl-3,6-dihydro-2H-pyridine (PubChem CID 126494315) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is 4-[(2E,4Z)-6-methylsulfanylhexa-2,4-dien-2-yl]-1-propyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-[(2E,4Z)-6-methylsulfanylhexa-2,4-dien-2-yl]-1-propyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 126494315 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 4-[(2E,4Z)-6-methylsulfanylhexa-2,4-dien-2-yl]-1-propyl-3,6-dihydro-2H-pyridine |
| SMILES | CCCN1CC=C(/C(C)=C/C=C\CSC)CC1 |
| InChI | InChI=1S/C15H25NS/c1-4-10-16-11-8-15(9-12-16)14(2)7-5-6-13-17-3/h5-8H,4,9-13H2,1-3H3/b6-5-,14-7+ |
| InChIKey | SVYIVULSEBUOLO-NTBKVEBNSA-N |
| XLogP | 3.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|