C30H52O6 — CID 126494444
[2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl] 4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate (PubChem CID 126494444) has the molecular formula C30H52O6 and a molecular weight of 508.74 g/mol. Its IUPAC name is [2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl] 4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate.
| Compound Name | [2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl] 4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
|---|---|
| PubChem CID | 126494444 |
| Molecular Formula | C30H52O6 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | [2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl] 4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
| SMILES | CC(CCC(=O)OCC(O)OC(C)(C)C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C30H52O6/c1-18(7-12-26(33)35-17-27(34)36-28(2,3)4)22-10-11-23-21-9-8-19-15-20(31)13-14-29(19,5)24(21)16-25(32)30(22,23)6/h18-25,27,31-32,34H,7-17H2,1-6H3 |
| InChIKey | RGOQGDPHALDKGP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|