C22H19F3N6S2 — CID 126494580
N,N-diethyl-4-[[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]aniline (PubChem CID 126494580) has the molecular formula C22H19F3N6S2 and a molecular weight of 488.56 g/mol. Its IUPAC name is N,N-diethyl-4-[[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]aniline.
| Compound Name | N,N-diethyl-4-[[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]aniline |
|---|---|
| PubChem CID | 126494580 |
| Molecular Formula | C22H19F3N6S2 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N,N-diethyl-4-[[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazenyl]aniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc3sc(/N=N/c4ccc(C(F)(F)F)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C22H19F3N6S2/c1-3-31(4-2)17-11-9-16(10-12-17)28-30-21-26-20-18(32-21)13-19(33-20)29-27-15-7-5-14(6-8-15)22(23,24)25/h5-13H,3-4H2,1-2H3/b29-27+,30-28+ |
| InChIKey | CMQKSLRGPYZQGZ-QAVVBOBSSA-N |
| XLogP | 9.05 |
| TPSA | 65.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|