C22H17F3N6S2 — CID 126494585
(4-pyrrolidin-1-ylphenyl)-[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene (PubChem CID 126494585) has the molecular formula C22H17F3N6S2 and a molecular weight of 486.55 g/mol. Its IUPAC name is (4-pyrrolidin-1-ylphenyl)-[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene.
| Compound Name | (4-pyrrolidin-1-ylphenyl)-[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene |
|---|---|
| PubChem CID | 126494585 |
| Molecular Formula | C22H17F3N6S2 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | (4-pyrrolidin-1-ylphenyl)-[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene |
| SMILES | FC(F)(F)c1ccc(/N=N/c2cc3sc(/N=N/c4ccc(N5CCCC5)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C22H17F3N6S2/c23-22(24,25)14-3-5-15(6-4-14)27-29-19-13-18-20(33-19)26-21(32-18)30-28-16-7-9-17(10-8-16)31-11-1-2-12-31/h3-10,13H,1-2,11-12H2/b29-27+,30-28+ |
| InChIKey | MPSAVZOXWSLZET-QAVVBOBSSA-N |
| XLogP | 8.81 |
| TPSA | 65.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|