About 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile
4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile (PubChem CID 126494636) has the molecular formula C22H18N6OS2
and a molecular weight of 446.56 g/mol. Its IUPAC name is 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile |
| PubChem CID | 126494636 |
| Molecular Formula | C22H18N6OS2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile |
| SMILES | CCCCOc1ccc(/N=N/c2nc3sc(/N=N/c4ccc(C#N)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C22H18N6OS2/c1-2-3-12-29-18-10-8-17(9-11-18)26-28-22-24-21-19(30-22)13-20(31-21)27-25-16-6-4-15(14-23)5-7-16/h4-11,13H,2-3,12H2,1H3/b27-25+,28-26+ |
| InChIKey | XRRHNMTZDNKNDK-NBHCHVEOSA-N |
| XLogP | 8.24 |
| TPSA | 95.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile?
The IUPAC name of 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile (CID 126494636) is 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile.
What is the SMILES notation for 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile?
The canonical SMILES for 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile is CCCCOc1ccc(/N=N/c2nc3sc(/N=N/c4ccc(C#N)cc4)cc3s2)cc1.
What is the InChIKey of 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile?
The InChIKey is XRRHNMTZDNKNDK-NBHCHVEOSA-N. The full InChI is InChI=1S/C22H18N6OS2/c1-2-3-12-29-18-10-8-17(9-11-18)26-28-22-24-21-19(30-22)13-20(31-21)27-25-16-6-4-15(14-23)5-7-16/h4-11,13H,2-3,12H2,1H3/b27-25+,28-26+.
What are the key properties of 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile?
4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile has a molecular weight of 446.56 g/mol, XLogP of 8.24, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-[(4-butoxyphenyl)diazenyl]thieno[2,3-d][1,3]thiazol-5-yl]diazenyl]benzonitrile is sourced from PubChem (CID 126494636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).