C22H18F3N5OS2 — CID 126494639
(4-butoxyphenyl)-[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene (PubChem CID 126494639) has the molecular formula C22H18F3N5OS2 and a molecular weight of 489.55 g/mol. Its IUPAC name is (4-butoxyphenyl)-[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene.
| Compound Name | (4-butoxyphenyl)-[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene |
|---|---|
| PubChem CID | 126494639 |
| Molecular Formula | C22H18F3N5OS2 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (4-butoxyphenyl)-[5-[[4-(trifluoromethyl)phenyl]diazenyl]thieno[2,3-d][1,3]thiazol-2-yl]diazene |
| SMILES | CCCCOc1ccc(/N=N/c2nc3sc(/N=N/c4ccc(C(F)(F)F)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C22H18F3N5OS2/c1-2-3-12-31-17-10-8-16(9-11-17)28-30-21-26-20-18(32-21)13-19(33-20)29-27-15-6-4-14(5-7-15)22(23,24)25/h4-11,13H,2-3,12H2,1H3/b29-27+,30-28+ |
| InChIKey | GOBBHNQZOSBTNN-QAVVBOBSSA-N |
| XLogP | 9.39 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|