C17H24N2O6 — CID 126494649
3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-nitrophenyl)butanoic acid (PubChem CID 126494649) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-nitrophenyl)butanoic acid.
| Compound Name | 3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-nitrophenyl)butanoic acid |
|---|---|
| PubChem CID | 126494649 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-nitrophenyl)butanoic acid |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)C(C(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H24N2O6/c1-16(2,3)25-15(22)18-10-17(4,5)13(14(20)21)11-6-8-12(9-7-11)19(23)24/h6-9,13H,10H2,1-5H3,(H,18,22)(H,20,21) |
| InChIKey | KYPAHUHZLSVJEH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|