About (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol
(3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol (PubChem CID 12649513) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol.
Molecular Properties
| Compound Name | (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol |
| PubChem CID | 12649513 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol |
| SMILES | O[C@H]1CC2CC3CC2[C@H]1C3 |
| InChI | InChI=1S/C9H14O/c10-9-4-6-1-5-2-7(6)8(9)3-5/h5-10H,1-4H2/t5?,6?,7?,8-,9+/m1/s1 |
| InChIKey | ZLVXOGJCUQABGP-DVIOUDORSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol?
The IUPAC name of (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol (CID 12649513) is (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol.
What is the SMILES notation for (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol?
The canonical SMILES for (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol is O[C@H]1CC2CC3CC2[C@H]1C3.
What is the InChIKey of (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol?
The InChIKey is ZLVXOGJCUQABGP-DVIOUDORSA-N. The full InChI is InChI=1S/C9H14O/c10-9-4-6-1-5-2-7(6)8(9)3-5/h5-10H,1-4H2/t5?,6?,7?,8-,9+/m1/s1.
What are the key properties of (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol?
(3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol has a molecular weight of 138.21 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-tricyclo[4.2.1.03,7]nonan-4-ol is sourced from PubChem (CID 12649513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).