C21H32O3 — CID 126495450
4-(3-cyclohepta-1,3,6-trien-1-yloxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one (PubChem CID 126495450) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 4-(3-cyclohepta-1,3,6-trien-1-yloxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one.
| Compound Name | 4-(3-cyclohepta-1,3,6-trien-1-yloxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 126495450 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 4-(3-cyclohepta-1,3,6-trien-1-yloxy-3-methylpentoxy)-2,4-dimethylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)(CC)OCCC(C)(CC)OC1=CC=CCC=C1 |
| InChI | InChI=1S/C21H32O3/c1-7-20(5,24-18-13-11-9-10-12-14-18)15-16-23-21(6,8-2)19(22)17(3)4/h9,11-14H,3,7-8,10,15-16H2,1-2,4-6H3 |
| InChIKey | DOKULKRCWMQRQK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|