About (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide
(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide (PubChem CID 126495583) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide.
Molecular Properties
| Compound Name | (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide |
| PubChem CID | 126495583 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide |
| SMILES | C=C/C=C(\C=C/C)C(=O)NN |
| InChI | InChI=1S/C8H12N2O/c1-3-5-7(6-4-2)8(11)10-9/h3-6H,1,9H2,2H3,(H,10,11)/b6-4-,7-5+ |
| InChIKey | NLNQZBXUWHSJBZ-XGXWUAJZSA-N |
| XLogP | 0.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide?
The IUPAC name of (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide (CID 126495583) is (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide.
What is the SMILES notation for (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide?
The canonical SMILES for (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide is C=C/C=C(\C=C/C)C(=O)NN.
What is the InChIKey of (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide?
The InChIKey is NLNQZBXUWHSJBZ-XGXWUAJZSA-N. The full InChI is InChI=1S/C8H12N2O/c1-3-5-7(6-4-2)8(11)10-9/h3-6H,1,9H2,2H3,(H,10,11)/b6-4-,7-5+.
What are the key properties of (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide?
(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide has a molecular weight of 152.20 g/mol, XLogP of 0.66, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide is sourced from PubChem (CID 126495583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).