About 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine
7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine (PubChem CID 126495616) has the molecular formula C19H19N5O2S
and a molecular weight of 381.46 g/mol. Its IUPAC name is 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine |
| PubChem CID | 126495616 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine |
| SMILES | COc1ccc(-c2c(C)sc3cnc(Nc4cnn(C)c4)nc23)c(OC)c1 |
| InChI | InChI=1S/C19H19N5O2S/c1-11-17(14-6-5-13(25-3)7-15(14)26-4)18-16(27-11)9-20-19(23-18)22-12-8-21-24(2)10-12/h5-10H,1-4H3,(H,20,22,23) |
| InChIKey | JZHRJXQSXLXGKH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine?
The IUPAC name of 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine (CID 126495616) is 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine is COc1ccc(-c2c(C)sc3cnc(Nc4cnn(C)c4)nc23)c(OC)c1.
What is the InChIKey of 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine?
The InChIKey is JZHRJXQSXLXGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O2S/c1-11-17(14-6-5-13(25-3)7-15(14)26-4)18-16(27-11)9-20-19(23-18)22-12-8-21-24(2)10-12/h5-10H,1-4H3,(H,20,22,23).
What are the key properties of 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine?
7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine has a molecular weight of 381.46 g/mol, XLogP of 4.16, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,4-dimethoxyphenyl)-6-methyl-N-(1-methylpyrazol-4-yl)thieno[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 126495616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).