C13H20N2 — CID 126495685
(2E,4Z)-N-[[(Z,2E)-2-ethylidenepent-3-enylidene]amino]hexa-2,4-dien-3-amine (PubChem CID 126495685) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (2E,4Z)-N-[[(Z,2E)-2-ethylidenepent-3-enylidene]amino]hexa-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-N-[[(Z,2E)-2-ethylidenepent-3-enylidene]amino]hexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 126495685 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2E,4Z)-N-[[(Z,2E)-2-ethylidenepent-3-enylidene]amino]hexa-2,4-dien-3-amine |
| SMILES | C/C=C\C(C=NNC(/C=C\C)=C/C)=C/C |
| InChI | InChI=1S/C13H20N2/c1-5-9-12(7-3)11-14-15-13(8-4)10-6-2/h5-11,15H,1-4H3/b9-5-,10-6-,12-7+,13-8+,14-11? |
| InChIKey | XXEALYGMSWIYBN-WGJINMIBSA-N |
| XLogP | 3.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|