C23H28N6OS — CID 126495720
2-[4-(2-methoxyphenyl)-2,5-dimethylthiophen-3-yl]-1-methylidene-3-(1-piperidin-4-ylpyrazol-4-yl)guanidine (PubChem CID 126495720) has the molecular formula C23H28N6OS and a molecular weight of 436.59 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)-2,5-dimethylthiophen-3-yl]-1-methylidene-3-(1-piperidin-4-ylpyrazol-4-yl)guanidine.
| Compound Name | 2-[4-(2-methoxyphenyl)-2,5-dimethylthiophen-3-yl]-1-methylidene-3-(1-piperidin-4-ylpyrazol-4-yl)guanidine |
|---|---|
| PubChem CID | 126495720 |
| Molecular Formula | C23H28N6OS |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)-2,5-dimethylthiophen-3-yl]-1-methylidene-3-(1-piperidin-4-ylpyrazol-4-yl)guanidine |
| SMILES | C=N/C(=N\c1c(C)sc(C)c1-c1ccccc1OC)Nc1cnn(C2CCNCC2)c1 |
| InChI | InChI=1S/C23H28N6OS/c1-15-21(19-7-5-6-8-20(19)30-4)22(16(2)31-15)28-23(24-3)27-17-13-26-29(14-17)18-9-11-25-12-10-18/h5-8,13-14,18,25H,3,9-12H2,1-2,4H3,(H,27,28) |
| InChIKey | QLEXEJSRRWRGLR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|