C65H116N4O20 — CID 126495744
1-O-[2,3-bis[[9-(butylaminooxy)-9-oxononanoyl]oxy]propyl] 9-O-[3-[7-(butylaminooxy)-7-oxoheptanoyl]oxy-2-[9-(butylaminooxy)-9-oxononanoyl]oxypropyl] nonanedioate (PubChem CID 126495744) has the molecular formula C65H116N4O20 and a molecular weight of 1273.65 g/mol. Its IUPAC name is 1-O-[2,3-bis[[9-(butylaminooxy)-9-oxononanoyl]oxy]propyl] 9-O-[3-[7-(butylaminooxy)-7-oxoheptanoyl]oxy-2-[9-(butylaminooxy)-9-oxononanoyl]oxypropyl] nonanedioate.
| Compound Name | 1-O-[2,3-bis[[9-(butylaminooxy)-9-oxononanoyl]oxy]propyl] 9-O-[3-[7-(butylaminooxy)-7-oxoheptanoyl]oxy-2-[9-(butylaminooxy)-9-oxononanoyl]oxypropyl] nonanedioate |
|---|---|
| PubChem CID | 126495744 |
| Molecular Formula | C65H116N4O20 |
| Molecular Weight | 1273.65 g/mol |
| Exact Mass | 1272.82 |
| IUPAC Name | 1-O-[2,3-bis[[9-(butylaminooxy)-9-oxononanoyl]oxy]propyl] 9-O-[3-[7-(butylaminooxy)-7-oxoheptanoyl]oxy-2-[9-(butylaminooxy)-9-oxononanoyl]oxypropyl] nonanedioate |
| SMILES | CCCCNOC(=O)CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC(=O)OCC(COC(=O)CCCCCC(=O)ONCCCC)OC(=O)CCCCCCCC(=O)ONCCCC)OC(=O)CCCCCCCC(=O)ONCCCC |
| InChI | InChI=1S/C65H116N4O20/c1-5-9-46-66-86-62(76)42-31-22-14-19-28-38-58(72)81-51-54(84-60(74)40-29-20-15-23-32-43-63(77)87-67-47-10-6-2)50-80-56(70)36-26-17-13-18-27-37-57(71)82-52-55(53-83-59(73)39-34-25-35-45-65(79)89-69-49-12-8-4)85-61(75)41-30-21-16-24-33-44-64(78)88-68-48-11-7-3/h54-55,66-69H,5-53H2,1-4H3 |
| InChIKey | LNEOFZATQBQORW-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 311.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 64 |
| Heavy Atoms | 89 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1273.65 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|