About 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole
2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole (PubChem CID 126495844) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole |
| PubChem CID | 126495844 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole |
| SMILES | Cc1cnc(-c2coc(C)n2)[nH]1 |
| InChI | InChI=1S/C8H9N3O/c1-5-3-9-8(10-5)7-4-12-6(2)11-7/h3-4H,1-2H3,(H,9,10) |
| InChIKey | GROSYUBAIDMPNT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole?
The IUPAC name of 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole (CID 126495844) is 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole.
What is the SMILES notation for 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole?
The canonical SMILES for 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole is Cc1cnc(-c2coc(C)n2)[nH]1.
What is the InChIKey of 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole?
The InChIKey is GROSYUBAIDMPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5-3-9-8(10-5)7-4-12-6(2)11-7/h3-4H,1-2H3,(H,9,10).
What are the key properties of 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole?
2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole has a molecular weight of 163.18 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(5-methyl-1H-imidazol-2-yl)-1,3-oxazole is sourced from PubChem (CID 126495844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).