About N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide
N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide (PubChem CID 12649587) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide |
| PubChem CID | 12649587 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)/C=N/NC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O/c1-9(2,3)7-11-12-8(13)10(4,5)6/h7H,1-6H3,(H,12,13)/b11-7+ |
| InChIKey | CGXDNXAYMLHFOC-YRNVUSSQSA-N |
| XLogP | 2.18 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide?
The IUPAC name of N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide (CID 12649587) is N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide is CC(C)(C)/C=N/NC(=O)C(C)(C)C.
What is the InChIKey of N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide?
The InChIKey is CGXDNXAYMLHFOC-YRNVUSSQSA-N. The full InChI is InChI=1S/C10H20N2O/c1-9(2,3)7-11-12-8(13)10(4,5)6/h7H,1-6H3,(H,12,13)/b11-7+.
What are the key properties of N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide?
N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide has a molecular weight of 184.28 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2,2-dimethylpropylideneamino]-2,2-dimethylpropanamide is sourced from PubChem (CID 12649587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).