C25H23N5OS — CID 126496319
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-quinolin-3-ylphenyl)methylamino]methanol (PubChem CID 126496319) has the molecular formula C25H23N5OS and a molecular weight of 441.56 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-quinolin-3-ylphenyl)methylamino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-quinolin-3-ylphenyl)methylamino]methanol |
|---|---|
| PubChem CID | 126496319 |
| Molecular Formula | C25H23N5OS |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-quinolin-3-ylphenyl)methylamino]methanol |
| SMILES | Cc1nnc2sc(C(O)NCc3ccc(-c4cnc5ccccc5c4)cc3)c(N)c2c1C |
| InChI | InChI=1S/C25H23N5OS/c1-14-15(2)29-30-25-21(14)22(26)23(32-25)24(31)28-12-16-7-9-17(10-8-16)19-11-18-5-3-4-6-20(18)27-13-19/h3-11,13,24,28,31H,12,26H2,1-2H3 |
| InChIKey | RGCQLQYDOBUHIS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|