C16H16F2N4OS — CID 126496322
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2,3-difluorophenyl)methylamino]methanol (PubChem CID 126496322) has the molecular formula C16H16F2N4OS and a molecular weight of 350.39 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2,3-difluorophenyl)methylamino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2,3-difluorophenyl)methylamino]methanol |
|---|---|
| PubChem CID | 126496322 |
| Molecular Formula | C16H16F2N4OS |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2,3-difluorophenyl)methylamino]methanol |
| SMILES | Cc1nnc2sc(C(O)NCc3cccc(F)c3F)c(N)c2c1C |
| InChI | InChI=1S/C16H16F2N4OS/c1-7-8(2)21-22-16-11(7)13(19)14(24-16)15(23)20-6-9-4-3-5-10(17)12(9)18/h3-5,15,20,23H,6,19H2,1-2H3 |
| InChIKey | GKRYRRWKBBMTNL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|