About 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol
1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol (PubChem CID 126496330) has the molecular formula C18H20N4O2S
and a molecular weight of 356.45 g/mol. Its IUPAC name is 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol.
Molecular Properties
| Compound Name | 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol |
| PubChem CID | 126496330 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol |
| SMILES | Cc1nnc2sc(C(O)N3CC(O)(c4ccccc4)C3)c(N)c2c1C |
| InChI | InChI=1S/C18H20N4O2S/c1-10-11(2)20-21-16-13(10)14(19)15(25-16)17(23)22-8-18(24,9-22)12-6-4-3-5-7-12/h3-7,17,23-24H,8-9,19H2,1-2H3 |
| InChIKey | DJFAYYYXVJBWAM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol?
The IUPAC name of 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol (CID 126496330) is 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol.
What is the SMILES notation for 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol?
The canonical SMILES for 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol is Cc1nnc2sc(C(O)N3CC(O)(c4ccccc4)C3)c(N)c2c1C.
What is the InChIKey of 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol?
The InChIKey is DJFAYYYXVJBWAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O2S/c1-10-11(2)20-21-16-13(10)14(19)15(25-16)17(23)22-8-18(24,9-22)12-6-4-3-5-7-12/h3-7,17,23-24H,8-9,19H2,1-2H3.
What are the key properties of 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol?
1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol has a molecular weight of 356.45 g/mol, XLogP of 2.08, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-hydroxymethyl]-3-phenylazetidin-3-ol is sourced from PubChem (CID 126496330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).