About (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol (PubChem CID 126496342) has the molecular formula C17H20N4O2S
and a molecular weight of 344.44 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol.
Molecular Properties
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol |
| PubChem CID | 126496342 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol |
| SMILES | COc1ccc(CNC(O)c2sc3nnc(C)c(C)c3c2N)cc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-9-10(2)20-21-17-13(9)14(18)15(24-17)16(22)19-8-11-4-6-12(23-3)7-5-11/h4-7,16,19,22H,8,18H2,1-3H3 |
| InChIKey | YNZJLGLGQABGHX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol?
The IUPAC name of (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol (CID 126496342) is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol.
What is the SMILES notation for (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol?
The canonical SMILES for (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol is COc1ccc(CNC(O)c2sc3nnc(C)c(C)c3c2N)cc1.
What is the InChIKey of (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol?
The InChIKey is YNZJLGLGQABGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O2S/c1-9-10(2)20-21-17-13(9)14(18)15(24-17)16(22)19-8-11-4-6-12(23-3)7-5-11/h4-7,16,19,22H,8,18H2,1-3H3.
What are the key properties of (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol?
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol has a molecular weight of 344.44 g/mol, XLogP of 2.68, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-methoxyphenyl)methylamino]methanol is sourced from PubChem (CID 126496342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).