About (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol (PubChem CID 126496374) has the molecular formula C14H20N4OS
and a molecular weight of 292.41 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol.
Molecular Properties
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol |
| PubChem CID | 126496374 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol |
| SMILES | Cc1nnc2sc(C(O)N3CCC[C@H]3C)c(N)c2c1C |
| InChI | InChI=1S/C14H20N4OS/c1-7-5-4-6-18(7)14(19)12-11(15)10-8(2)9(3)16-17-13(10)20-12/h7,14,19H,4-6,15H2,1-3H3/t7-,14?/m1/s1 |
| InChIKey | IDRBJHIVVYXVRW-SKKCEABJSA-N |
| XLogP | 2.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol?
The IUPAC name of (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol (CID 126496374) is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol.
What is the SMILES notation for (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol?
The canonical SMILES for (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol is Cc1nnc2sc(C(O)N3CCC[C@H]3C)c(N)c2c1C.
What is the InChIKey of (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol?
The InChIKey is IDRBJHIVVYXVRW-SKKCEABJSA-N. The full InChI is InChI=1S/C14H20N4OS/c1-7-5-4-6-18(7)14(19)12-11(15)10-8(2)9(3)16-17-13(10)20-12/h7,14,19H,4-6,15H2,1-3H3/t7-,14?/m1/s1.
What are the key properties of (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol?
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol has a molecular weight of 292.41 g/mol, XLogP of 2.37, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(2R)-2-methylpyrrolidin-1-yl]methanol is sourced from PubChem (CID 126496374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).