C17H19FN4O2S — CID 126496375
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(3-fluoro-4-methoxyphenyl)methylamino]methanol (PubChem CID 126496375) has the molecular formula C17H19FN4O2S and a molecular weight of 362.43 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(3-fluoro-4-methoxyphenyl)methylamino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(3-fluoro-4-methoxyphenyl)methylamino]methanol |
|---|---|
| PubChem CID | 126496375 |
| Molecular Formula | C17H19FN4O2S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(3-fluoro-4-methoxyphenyl)methylamino]methanol |
| SMILES | COc1ccc(CNC(O)c2sc3nnc(C)c(C)c3c2N)cc1F |
| InChI | InChI=1S/C17H19FN4O2S/c1-8-9(2)21-22-17-13(8)14(19)15(25-17)16(23)20-7-10-4-5-12(24-3)11(18)6-10/h4-6,16,20,23H,7,19H2,1-3H3 |
| InChIKey | ZDQDFVAPRJVVMN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|