C17H18F2N4O2S2 — CID 126496393
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(difluoromethylsulfinyl)phenyl]methylamino]methanol (PubChem CID 126496393) has the molecular formula C17H18F2N4O2S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(difluoromethylsulfinyl)phenyl]methylamino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(difluoromethylsulfinyl)phenyl]methylamino]methanol |
|---|---|
| PubChem CID | 126496393 |
| Molecular Formula | C17H18F2N4O2S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(difluoromethylsulfinyl)phenyl]methylamino]methanol |
| SMILES | Cc1nnc2sc(C(O)NCc3ccc(S(=O)C(F)F)cc3)c(N)c2c1C |
| InChI | InChI=1S/C17H18F2N4O2S2/c1-8-9(2)22-23-16-12(8)13(20)14(26-16)15(24)21-7-10-3-5-11(6-4-10)27(25)17(18)19/h3-6,15,17,21,24H,7,20H2,1-2H3 |
| InChIKey | UUSWLCZQWUSQJQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|