C35H45N2O6PS — CID 126496962
3-[[(2R,5S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-5-sulfanyloxolan-2-yl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 126496962) has the molecular formula C35H45N2O6PS and a molecular weight of 652.79 g/mol. Its IUPAC name is 3-[[(2R,5S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-5-sulfanyloxolan-2-yl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,5S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-5-sulfanyloxolan-2-yl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 126496962 |
| Molecular Formula | C35H45N2O6PS |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 3-[[(2R,5S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-5-sulfanyloxolan-2-yl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OC2C[C@H](S)O[C@@H]2COP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H45N2O6PS/c1-25(2)37(26(3)4)44(40-22-10-21-36)41-24-33-32(23-34(45)42-33)43-35(27-11-8-7-9-12-27,28-13-17-30(38-5)18-14-28)29-15-19-31(39-6)20-16-29/h7-9,11-20,25-26,32-34,45H,10,22-24H2,1-6H3/t32?,33-,34+,44?/m1/s1 |
| InChIKey | XDVVJBLZRLAYGJ-WGGXEQKUSA-N |
| XLogP | 7.72 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|