C39H74N8O — CID 126496978
N'-butan-2-yl-N-(4-butan-2-yl-6-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine (PubChem CID 126496978) has the molecular formula C39H74N8O and a molecular weight of 671.08 g/mol. Its IUPAC name is N'-butan-2-yl-N-(4-butan-2-yl-6-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N'-butan-2-yl-N-(4-butan-2-yl-6-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 126496978 |
| Molecular Formula | C39H74N8O |
| Molecular Weight | 671.08 g/mol |
| Exact Mass | 670.60 |
| IUPAC Name | N'-butan-2-yl-N-(4-butan-2-yl-6-morpholin-4-yl-1,3,5-triazin-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CCC(C)c1nc(N2CCOCC2)nc(N(CCCCCCN(C(C)CC)C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C39H74N8O/c1-13-29(3)33-40-34(45-21-23-48-24-22-45)42-35(41-33)47(32-27-38(9,10)44-39(11,12)28-32)20-18-16-15-17-19-46(30(4)14-2)31-25-36(5,6)43-37(7,8)26-31/h29-32,43-44H,13-28H2,1-12H3 |
| InChIKey | DDLUGSRKUGWHPE-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.08 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|