About 1-oxido-2,4,5-triphenyltriazol-1-ium
1-oxido-2,4,5-triphenyltriazol-1-ium (PubChem CID 12649721) has the molecular formula C20H15N3O
and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-oxido-2,4,5-triphenyltriazol-1-ium.
Molecular Properties
| Compound Name | 1-oxido-2,4,5-triphenyltriazol-1-ium |
| PubChem CID | 12649721 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-oxido-2,4,5-triphenyltriazol-1-ium |
| SMILES | [O-][n+]1c(-c2ccccc2)c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C20H15N3O/c24-23-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21-22(23)18-14-8-3-9-15-18/h1-15H |
| InChIKey | BARMMMIGTKOSIM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-oxido-2,4,5-triphenyltriazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxido-2,4,5-triphenyltriazol-1-ium?
The IUPAC name of 1-oxido-2,4,5-triphenyltriazol-1-ium (CID 12649721) is 1-oxido-2,4,5-triphenyltriazol-1-ium.
What is the SMILES notation for 1-oxido-2,4,5-triphenyltriazol-1-ium?
The canonical SMILES for 1-oxido-2,4,5-triphenyltriazol-1-ium is [O-][n+]1c(-c2ccccc2)c(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of 1-oxido-2,4,5-triphenyltriazol-1-ium?
The InChIKey is BARMMMIGTKOSIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O/c24-23-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21-22(23)18-14-8-3-9-15-18/h1-15H.
What are the key properties of 1-oxido-2,4,5-triphenyltriazol-1-ium?
1-oxido-2,4,5-triphenyltriazol-1-ium has a molecular weight of 313.36 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxido-2,4,5-triphenyltriazol-1-ium is sourced from PubChem (CID 12649721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).