About 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine
1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine (PubChem CID 126497356) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine.
Molecular Properties
| Compound Name | 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine |
| PubChem CID | 126497356 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine |
| SMILES | C=C(CNNC)/C(C)=C\C=C/C |
| InChI | InChI=1S/C10H18N2/c1-5-6-7-9(2)10(3)8-12-11-4/h5-7,11-12H,3,8H2,1-2,4H3/b6-5-,9-7- |
| InChIKey | ZVLKBSXBZLNBIC-LZWBOMALSA-N |
| XLogP | 1.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine?
The IUPAC name of 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine (CID 126497356) is 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine.
What is the SMILES notation for 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine?
The canonical SMILES for 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine is C=C(CNNC)/C(C)=C\C=C/C.
What is the InChIKey of 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine?
The InChIKey is ZVLKBSXBZLNBIC-LZWBOMALSA-N. The full InChI is InChI=1S/C10H18N2/c1-5-6-7-9(2)10(3)8-12-11-4/h5-7,11-12H,3,8H2,1-2,4H3/b6-5-,9-7-.
What are the key properties of 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine?
1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine has a molecular weight of 166.27 g/mol, XLogP of 1.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[(3Z,5Z)-3-methyl-2-methylidenehepta-3,5-dienyl]hydrazine is sourced from PubChem (CID 126497356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).