C13H24NP — CID 126497389
cyclopentyl-propan-2-yl-(1,2,3,4-tetrahydropyridin-6-yl)phosphane (PubChem CID 126497389) has the molecular formula C13H24NP and a molecular weight of 225.32 g/mol. Its IUPAC name is cyclopentyl-propan-2-yl-(1,2,3,4-tetrahydropyridin-6-yl)phosphane.
| Compound Name | cyclopentyl-propan-2-yl-(1,2,3,4-tetrahydropyridin-6-yl)phosphane |
|---|---|
| PubChem CID | 126497389 |
| Molecular Formula | C13H24NP |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | cyclopentyl-propan-2-yl-(1,2,3,4-tetrahydropyridin-6-yl)phosphane |
| SMILES | CC(C)P(C1=CCCCN1)C1CCCC1 |
| InChI | InChI=1S/C13H24NP/c1-11(2)15(12-7-3-4-8-12)13-9-5-6-10-14-13/h9,11-12,14H,3-8,10H2,1-2H3 |
| InChIKey | QERVYWGBKQIPRI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|