About 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one
1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one (PubChem CID 126497400) has the molecular formula C13H15F3O2
and a molecular weight of 260.25 g/mol. Its IUPAC name is 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one |
| PubChem CID | 126497400 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one |
| SMILES | C/C=C1/C=C(C(=O)CC)C(C(F)(F)F)O/C1=C/C |
| InChI | InChI=1S/C13H15F3O2/c1-4-8-7-9(10(17)5-2)12(13(14,15)16)18-11(8)6-3/h4,6-7,12H,5H2,1-3H3/b8-4-,11-6+ |
| InChIKey | CGUSWDHGYACEFL-NOSMKPSFSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one?
The IUPAC name of 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one (CID 126497400) is 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one.
What is the SMILES notation for 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one?
The canonical SMILES for 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one is C/C=C1/C=C(C(=O)CC)C(C(F)(F)F)O/C1=C/C.
What is the InChIKey of 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one?
The InChIKey is CGUSWDHGYACEFL-NOSMKPSFSA-N. The full InChI is InChI=1S/C13H15F3O2/c1-4-8-7-9(10(17)5-2)12(13(14,15)16)18-11(8)6-3/h4,6-7,12H,5H2,1-3H3/b8-4-,11-6+.
What are the key properties of 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one?
1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one has a molecular weight of 260.25 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-yl]propan-1-one is sourced from PubChem (CID 126497400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).