C7H4F5NOS — CID 126498062
1-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 126498062) has the molecular formula C7H4F5NOS and a molecular weight of 245.17 g/mol. Its IUPAC name is 1-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 126498062 |
| Molecular Formula | C7H4F5NOS |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 1-[2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C7H4F5NOS/c1-3(14)4-2-15-5(13-4)6(8,9)7(10,11)12/h2H,1H3 |
| InChIKey | MNJFVJHLGLZKGG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|