C28H31N5O2 — CID 126498198
2-[(1R,2S,13R)-22-(cyclopropylmethyl)-2,16-dihydroxy-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-7-yl]guanidine (PubChem CID 126498198) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[(1R,2S,13R)-22-(cyclopropylmethyl)-2,16-dihydroxy-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-7-yl]guanidine.
| Compound Name | 2-[(1R,2S,13R)-22-(cyclopropylmethyl)-2,16-dihydroxy-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-7-yl]guanidine |
|---|---|
| PubChem CID | 126498198 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 2-[(1R,2S,13R)-22-(cyclopropylmethyl)-2,16-dihydroxy-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5(10),6,8,15,17,19(25)-heptaen-7-yl]guanidine |
| SMILES | NC(N)=Nc1ccc2[nH]c3c(c2c1)C[C@@]1(O)C2Cc4ccc(O)c5c4[C@@]1(CCN2CC1CC1)[C@H]3C5 |
| InChI | InChI=1S/C28H31N5O2/c29-26(30)31-16-4-5-21-17(10-16)19-12-28(35)23-9-15-3-6-22(34)18-11-20(25(19)32-21)27(28,24(15)18)7-8-33(23)13-14-1-2-14/h3-6,10,14,20,23,32,34-35H,1-2,7-9,11-13H2,(H4,29,30,31)/t20-,23?,27+,28+/m0/s1 |
| InChIKey | OZNJQPUUUYWWSK-NNUPXMQXSA-N |
| XLogP | 2.68 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|