C24H35N3O — CID 126498847
(1S,9S,13R)-10-(cyclopropylmethyl)-1,12,13-trimethyl-4-(4-methylpiperazin-1-yl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 126498847) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is (1S,9S,13R)-10-(cyclopropylmethyl)-1,12,13-trimethyl-4-(4-methylpiperazin-1-yl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1S,9S,13R)-10-(cyclopropylmethyl)-1,12,13-trimethyl-4-(4-methylpiperazin-1-yl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 126498847 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | (1S,9S,13R)-10-(cyclopropylmethyl)-1,12,13-trimethyl-4-(4-methylpiperazin-1-yl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | CC1CN(CC2CC2)[C@@H]2C(=O)c3ccc(N4CCN(C)CC4)cc3[C@]1(C)[C@H]2C |
| InChI | InChI=1S/C24H35N3O/c1-16-14-27(15-18-5-6-18)22-17(2)24(16,3)21-13-19(7-8-20(21)23(22)28)26-11-9-25(4)10-12-26/h7-8,13,16-18,22H,5-6,9-12,14-15H2,1-4H3/t16?,17-,22-,24-/m0/s1 |
| InChIKey | WXGBAGORHLTLBP-NPBMKWMOSA-N |
| XLogP | 3.26 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |