C19H13F3N6O — CID 126499469
1-[4-[[2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-3-pyridinyl]ethenol (PubChem CID 126499469) has the molecular formula C19H13F3N6O and a molecular weight of 398.35 g/mol. Its IUPAC name is 1-[4-[[2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-3-pyridinyl]ethenol.
| Compound Name | 1-[4-[[2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-3-pyridinyl]ethenol |
|---|---|
| PubChem CID | 126499469 |
| Molecular Formula | C19H13F3N6O |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-[4-[[2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-3-pyridinyl]ethenol |
| SMILES | C=C(O)c1cnccc1Nc1nc(-c2cccc(C(F)(F)F)n2)nn2cccc12 |
| InChI | InChI=1S/C19H13F3N6O/c1-11(29)12-10-23-8-7-13(12)25-18-15-5-3-9-28(15)27-17(26-18)14-4-2-6-16(24-14)19(20,21)22/h2-10,29H,1H2,(H,23,25,26,27) |
| InChIKey | RZBCKBCCLADPGE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|