About (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine
(E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine (PubChem CID 126499499) has the molecular formula C12H19FN2
and a molecular weight of 210.30 g/mol. Its IUPAC name is (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine |
| PubChem CID | 126499499 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine |
| SMILES | C=CC(C)/C=C\C(C)C/N=C/C(F)=C\N |
| InChI | InChI=1S/C12H19FN2/c1-4-10(2)5-6-11(3)8-15-9-12(13)7-14/h4-7,9-11H,1,8,14H2,2-3H3/b6-5-,12-7+,15-9+ |
| InChIKey | SLZFNWZEXAMSNC-SSYODIPXSA-N |
| XLogP | 2.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine?
The IUPAC name of (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine (CID 126499499) is (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine.
What is the SMILES notation for (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine?
The canonical SMILES for (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine is C=CC(C)/C=C\C(C)C/N=C/C(F)=C\N.
What is the InChIKey of (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine?
The InChIKey is SLZFNWZEXAMSNC-SSYODIPXSA-N. The full InChI is InChI=1S/C12H19FN2/c1-4-10(2)5-6-11(3)8-15-9-12(13)7-14/h4-7,9-11H,1,8,14H2,2-3H3/b6-5-,12-7+,15-9+.
What are the key properties of (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine?
(E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine has a molecular weight of 210.30 g/mol, XLogP of 2.84, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[(3Z)-2,5-dimethylhepta-3,6-dienyl]imino-2-fluoroprop-1-en-1-amine is sourced from PubChem (CID 126499499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).