C24H25FN8O3S — CID 126499607
N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-[[2-(5-fluoro-6-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide (PubChem CID 126499607) has the molecular formula C24H25FN8O3S and a molecular weight of 524.58 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-[[2-(5-fluoro-6-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide.
| Compound Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-[[2-(5-fluoro-6-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126499607 |
| Molecular Formula | C24H25FN8O3S |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-[[2-(5-fluoro-6-methyl-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide |
| SMILES | Cc1nc(-c2nc(Nc3ccncc3C(=O)NCCN3CCS(=O)(=O)CC3)c3cccn3n2)ccc1F |
| InChI | InChI=1S/C24H25FN8O3S/c1-16-18(25)4-5-20(28-16)22-30-23(21-3-2-9-33(21)31-22)29-19-6-7-26-15-17(19)24(34)27-8-10-32-11-13-37(35,36)14-12-32/h2-7,9,15H,8,10-14H2,1H3,(H,27,34)(H,26,29,30,31) |
| InChIKey | JHAAIKKZCDBRGN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |