C19H19N5O2 — CID 126499613
methyl 4-[[(2E)-1-[[amino-(6-methyl-2-pyridinyl)methylidene]amino]penta-2,4-dienylidene]amino]pyridine-3-carboxylate (PubChem CID 126499613) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is methyl 4-[[(2E)-1-[[amino-(6-methyl-2-pyridinyl)methylidene]amino]penta-2,4-dienylidene]amino]pyridine-3-carboxylate.
| Compound Name | methyl 4-[[(2E)-1-[[amino-(6-methyl-2-pyridinyl)methylidene]amino]penta-2,4-dienylidene]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126499613 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | methyl 4-[[(2E)-1-[[amino-(6-methyl-2-pyridinyl)methylidene]amino]penta-2,4-dienylidene]amino]pyridine-3-carboxylate |
| SMILES | C=C/C=C/C(=N/c1ccncc1C(=O)OC)/N=C(\N)c1cccc(C)n1 |
| InChI | InChI=1S/C19H19N5O2/c1-4-5-9-17(24-18(20)16-8-6-7-13(2)22-16)23-15-10-11-21-12-14(15)19(25)26-3/h4-12H,1H2,2-3H3,(H2,20,21,23,24)/b9-5+ |
| InChIKey | CAVVAUULVJFFFN-WEVVVXLNSA-N |
| XLogP | 2.75 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|