C24H23F3N8O3S — CID 126499640
N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-[[2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide (PubChem CID 126499640) has the molecular formula C24H23F3N8O3S and a molecular weight of 560.56 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-[[2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide.
| Compound Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-[[2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126499640 |
| Molecular Formula | C24H23F3N8O3S |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-[[2-[6-(trifluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]pyridine-3-carboxamide |
| SMILES | O=C(NCCN1CCS(=O)(=O)CC1)c1cnccc1Nc1nc(-c2cccc(C(F)(F)F)n2)nn2cccc12 |
| InChI | InChI=1S/C24H23F3N8O3S/c25-24(26,27)20-5-1-3-18(30-20)21-32-22(19-4-2-9-35(19)33-21)31-17-6-7-28-15-16(17)23(36)29-8-10-34-11-13-39(37,38)14-12-34/h1-7,9,15H,8,10-14H2,(H,29,36)(H,28,31,32,33) |
| InChIKey | SMZZVKKOSAQKCF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |