C23H21FN6 — CID 126499741
N-(3-fluoro-4-pyridinyl)-5-(5-methylhex-2-ynyl)-2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 126499741) has the molecular formula C23H21FN6 and a molecular weight of 400.46 g/mol. Its IUPAC name is N-(3-fluoro-4-pyridinyl)-5-(5-methylhex-2-ynyl)-2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-(3-fluoro-4-pyridinyl)-5-(5-methylhex-2-ynyl)-2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 126499741 |
| Molecular Formula | C23H21FN6 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(3-fluoro-4-pyridinyl)-5-(5-methylhex-2-ynyl)-2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CC(C)CC#CCc1ccn2nc(-c3ccccn3)nc(Nc3ccncc3F)c12 |
| InChI | InChI=1S/C23H21FN6/c1-16(2)7-3-4-8-17-11-14-30-21(17)23(27-19-10-13-25-15-18(19)24)28-22(29-30)20-9-5-6-12-26-20/h5-6,9-16H,7-8H2,1-2H3,(H,25,27,28,29) |
| InChIKey | AOMGCHCCZJRSKI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|