About 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine
2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine (PubChem CID 126499774) has the molecular formula C17H11FN4O
and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine.
Molecular Properties
| Compound Name | 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine |
| PubChem CID | 126499774 |
| Molecular Formula | C17H11FN4O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine |
| SMILES | Fc1cccc(-c2nc(Oc3ccccc3)c3cccn3n2)n1 |
| InChI | InChI=1S/C17H11FN4O/c18-15-10-4-8-13(19-15)16-20-17(14-9-5-11-22(14)21-16)23-12-6-2-1-3-7-12/h1-11H |
| InChIKey | KNUIXQMOJDUNHR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine?
The IUPAC name of 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine (CID 126499774) is 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine.
What is the SMILES notation for 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine?
The canonical SMILES for 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine is Fc1cccc(-c2nc(Oc3ccccc3)c3cccn3n2)n1.
What is the InChIKey of 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine?
The InChIKey is KNUIXQMOJDUNHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FN4O/c18-15-10-4-8-13(19-15)16-20-17(14-9-5-11-22(14)21-16)23-12-6-2-1-3-7-12/h1-11H.
What are the key properties of 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine?
2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine has a molecular weight of 306.30 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-2-pyridinyl)-4-phenoxypyrrolo[2,1-f][1,2,4]triazine is sourced from PubChem (CID 126499774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).