C10H16FN — CID 126499829
(3Z,5Z)-3-fluorodeca-1,3,5-trien-4-amine (PubChem CID 126499829) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is (3Z,5Z)-3-fluorodeca-1,3,5-trien-4-amine.
| Compound Name | (3Z,5Z)-3-fluorodeca-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 126499829 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (3Z,5Z)-3-fluorodeca-1,3,5-trien-4-amine |
| SMILES | C=C/C(F)=C(N)\C=C/CCCC |
| InChI | InChI=1S/C10H16FN/c1-3-5-6-7-8-10(12)9(11)4-2/h4,7-8H,2-3,5-6,12H2,1H3/b8-7-,10-9- |
| InChIKey | WNKKLZZODGLTCX-QRLRYFCNSA-N |
| XLogP | 3.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|