C17H11F3N4OS — CID 126499886
2-(4-phenoxypyrrolo[2,1-f][1,2,4]triazin-2-yl)-4-(2,2,2-trifluoroethyl)-1,3-thiazole (PubChem CID 126499886) has the molecular formula C17H11F3N4OS and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-(4-phenoxypyrrolo[2,1-f][1,2,4]triazin-2-yl)-4-(2,2,2-trifluoroethyl)-1,3-thiazole.
| Compound Name | 2-(4-phenoxypyrrolo[2,1-f][1,2,4]triazin-2-yl)-4-(2,2,2-trifluoroethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 126499886 |
| Molecular Formula | C17H11F3N4OS |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-(4-phenoxypyrrolo[2,1-f][1,2,4]triazin-2-yl)-4-(2,2,2-trifluoroethyl)-1,3-thiazole |
| SMILES | FC(F)(F)Cc1csc(-c2nc(Oc3ccccc3)c3cccn3n2)n1 |
| InChI | InChI=1S/C17H11F3N4OS/c18-17(19,20)9-11-10-26-16(21-11)14-22-15(13-7-4-8-24(13)23-14)25-12-5-2-1-3-6-12/h1-8,10H,9H2 |
| InChIKey | PAVWDTHNSDFRMS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |