About 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one
1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one (PubChem CID 126500001) has the molecular formula C9H15FO
and a molecular weight of 158.22 g/mol. Its IUPAC name is 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one |
| PubChem CID | 126500001 |
| Molecular Formula | C9H15FO |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one |
| SMILES | CCC(C)(C)C(=O)[C@H]1C[C@H]1F |
| InChI | InChI=1S/C9H15FO/c1-4-9(2,3)8(11)6-5-7(6)10/h6-7H,4-5H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | TYVUPHQOUZJHBZ-NKWVEPMBSA-N |
| XLogP | 2.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one?
The IUPAC name of 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one (CID 126500001) is 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one.
What is the SMILES notation for 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one?
The canonical SMILES for 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one is CCC(C)(C)C(=O)[C@H]1C[C@H]1F.
What is the InChIKey of 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one?
The InChIKey is TYVUPHQOUZJHBZ-NKWVEPMBSA-N. The full InChI is InChI=1S/C9H15FO/c1-4-9(2,3)8(11)6-5-7(6)10/h6-7H,4-5H2,1-3H3/t6-,7+/m0/s1.
What are the key properties of 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one?
1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one has a molecular weight of 158.22 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2R)-2-fluorocyclopropyl]-2,2-dimethylbutan-1-one is sourced from PubChem (CID 126500001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).