C7H13NO — CID 126500173
(2Z,4Z)-5-aminohepta-2,4-dien-4-ol (PubChem CID 126500173) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (2Z,4Z)-5-aminohepta-2,4-dien-4-ol.
| Compound Name | (2Z,4Z)-5-aminohepta-2,4-dien-4-ol |
|---|---|
| PubChem CID | 126500173 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (2Z,4Z)-5-aminohepta-2,4-dien-4-ol |
| SMILES | C/C=C\C(O)=C(\N)CC |
| InChI | InChI=1S/C7H13NO/c1-3-5-7(9)6(8)4-2/h3,5,9H,4,8H2,1-2H3/b5-3-,7-6- |
| InChIKey | OIKDLLIGCBRTAU-VKLRWAGZSA-N |
| XLogP | 1.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|