About N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide
N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide (PubChem CID 126500407) has the molecular formula C18H16N2O3
and a molecular weight of 308.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide |
| PubChem CID | 126500407 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide |
| SMILES | Cc1ccc2ccccc2c1NC(=O)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H16N2O3/c1-12-8-9-13-5-2-3-7-15(13)16(12)20-18(22)17(21)19-11-14-6-4-10-23-14/h2-10H,11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | IRODGGOKLWLTLV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide?
The IUPAC name of N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide (CID 126500407) is N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide.
What is the SMILES notation for N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide?
The canonical SMILES for N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide is Cc1ccc2ccccc2c1NC(=O)C(=O)NCc1ccco1.
What is the InChIKey of N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide?
The InChIKey is IRODGGOKLWLTLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O3/c1-12-8-9-13-5-2-3-7-15(13)16(12)20-18(22)17(21)19-11-14-6-4-10-23-14/h2-10H,11H2,1H3,(H,19,21)(H,20,22).
What are the key properties of N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide?
N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide has a molecular weight of 308.34 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-N'-(2-methylnaphthalen-1-yl)oxamide is sourced from PubChem (CID 126500407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).